C10H9BrClN3O2S2 — CID 4730084
5-bromo-6-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide (PubChem CID 4730084) has the molecular formula C10H9BrClN3O2S2 and a molecular weight of 382.69 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-6-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4730084 |
| Molecular Formula | C10H9BrClN3O2S2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 380.90 |
| IUPAC Name | 5-bromo-6-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2cnc(Cl)c(Br)c2)sc1C |
| InChI | InChI=1S/C10H9BrClN3O2S2/c1-5-6(2)18-10(14-5)15-19(16,17)7-3-8(11)9(12)13-4-7/h3-4H,1-2H3,(H,14,15) |
| InChIKey | LMZLHDFWWUJRES-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|