C15H16BrClN2O3S — CID 4686096
5-bromo-6-chloro-N-[2-(4-ethoxyphenyl)ethyl]pyridine-3-sulfonamide (PubChem CID 4686096) has the molecular formula C15H16BrClN2O3S and a molecular weight of 419.73 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-[2-(4-ethoxyphenyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-6-chloro-N-[2-(4-ethoxyphenyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4686096 |
| Molecular Formula | C15H16BrClN2O3S |
| Molecular Weight | 419.73 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 5-bromo-6-chloro-N-[2-(4-ethoxyphenyl)ethyl]pyridine-3-sulfonamide |
| SMILES | CCOc1ccc(CCNS(=O)(=O)c2cnc(Cl)c(Br)c2)cc1 |
| InChI | InChI=1S/C15H16BrClN2O3S/c1-2-22-12-5-3-11(4-6-12)7-8-19-23(20,21)13-9-14(16)15(17)18-10-13/h3-6,9-10,19H,2,7-8H2,1H3 |
| InChIKey | NJYJXTAYEDMLBL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|