C14H14Cl2N2O3S — CID 110295030
5,6-dichloro-N-[2-(3-methoxyphenyl)ethyl]pyridine-3-sulfonamide (PubChem CID 110295030) has the molecular formula C14H14Cl2N2O3S and a molecular weight of 361.25 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-(3-methoxyphenyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[2-(3-methoxyphenyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110295030 |
| Molecular Formula | C14H14Cl2N2O3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5,6-dichloro-N-[2-(3-methoxyphenyl)ethyl]pyridine-3-sulfonamide |
| SMILES | COc1cccc(CCNS(=O)(=O)c2cnc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H14Cl2N2O3S/c1-21-11-4-2-3-10(7-11)5-6-18-22(19,20)12-8-13(15)14(16)17-9-12/h2-4,7-9,18H,5-6H2,1H3 |
| InChIKey | ZOHKKVLOKCOEBF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|