C16H16ClNO4S — CID 173342920
4-chloro-N-[2-[3-(2-oxoethoxy)phenyl]ethyl]benzenesulfonamide (PubChem CID 173342920) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is 4-chloro-N-[2-[3-(2-oxoethoxy)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[3-(2-oxoethoxy)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 173342920 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-chloro-N-[2-[3-(2-oxoethoxy)phenyl]ethyl]benzenesulfonamide |
| SMILES | O=CCOc1cccc(CCNS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H16ClNO4S/c17-14-4-6-16(7-5-14)23(20,21)18-9-8-13-2-1-3-15(12-13)22-11-10-19/h1-7,10,12,18H,8-9,11H2 |
| InChIKey | OMMDHJBQMWNUCA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|