C16H14ClNO5S2 — CID 88510745
2-[3-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-2-sulfinylacetic acid (PubChem CID 88510745) has the molecular formula C16H14ClNO5S2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-[3-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-2-sulfinylacetic acid.
| Compound Name | 2-[3-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-2-sulfinylacetic acid |
|---|---|
| PubChem CID | 88510745 |
| Molecular Formula | C16H14ClNO5S2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 2-[3-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-2-sulfinylacetic acid |
| SMILES | O=S=C(C(=O)O)c1cccc(CCNS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H14ClNO5S2/c17-13-4-6-14(7-5-13)25(22,23)18-9-8-11-2-1-3-12(10-11)15(24-21)16(19)20/h1-7,10,18H,8-9H2,(H,19,20) |
| InChIKey | XSCOFNVKMXIGCX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|