C17H14ClNO5S — CID 14476316
4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylic acid (PubChem CID 14476316) has the molecular formula C17H14ClNO5S and a molecular weight of 379.82 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 14476316 |
| Molecular Formula | C17H14ClNO5S |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(CCNS(=O)(=O)c3ccc(Cl)cc3)cccc2o1 |
| InChI | InChI=1S/C17H14ClNO5S/c18-12-4-6-13(7-5-12)25(22,23)19-9-8-11-2-1-3-15-14(11)10-16(24-15)17(20)21/h1-7,10,19H,8-9H2,(H,20,21) |
| InChIKey | ASQKCKOVZDIMFL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |