C19H18ClNO5S — CID 14476291
ethyl 5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylate (PubChem CID 14476291) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is ethyl 5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 14476291 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | ethyl 5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(CCNS(=O)(=O)c3ccc(Cl)cc3)ccc2o1 |
| InChI | InChI=1S/C19H18ClNO5S/c1-2-25-19(22)18-12-14-11-13(3-8-17(14)26-18)9-10-21-27(23,24)16-6-4-15(20)5-7-16/h3-8,11-12,21H,2,9-10H2,1H3 |
| InChIKey | AFWMWGAKQHZBIT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |