C19H17ClN2O5S — CID 139612650
2-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-oxo-1H-quinolin-8-yl]acetic acid (PubChem CID 139612650) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is 2-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-oxo-1H-quinolin-8-yl]acetic acid.
| Compound Name | 2-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-oxo-1H-quinolin-8-yl]acetic acid |
|---|---|
| PubChem CID | 139612650 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-oxo-1H-quinolin-8-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CCNS(=O)(=O)c2ccc(Cl)cc2)c2ccc(=O)[nH]c12 |
| InChI | InChI=1S/C19H17ClN2O5S/c20-14-3-5-15(6-4-14)28(26,27)21-10-9-12-1-2-13(11-18(24)25)19-16(12)7-8-17(23)22-19/h1-8,21H,9-11H2,(H,22,23)(H,24,25) |
| InChIKey | AZUUOIXRJBUKST-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |