C16H14ClNO5S — CID 14536989
2-[4-[2-[(4-chlorophenyl)sulfonylamino]acetyl]phenyl]acetic acid (PubChem CID 14536989) has the molecular formula C16H14ClNO5S and a molecular weight of 367.81 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)sulfonylamino]acetyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]acetyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 14536989 |
| Molecular Formula | C16H14ClNO5S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]acetyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C(=O)CNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H14ClNO5S/c17-13-5-7-14(8-6-13)24(22,23)18-10-15(19)12-3-1-11(2-4-12)9-16(20)21/h1-8,18H,9-10H2,(H,20,21) |
| InChIKey | UYYZWOLZNMPLEH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |