C12H15NO5S — CID 82164610
2-[(4-butanoylphenyl)sulfonylamino]acetic acid (PubChem CID 82164610) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-[(4-butanoylphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(4-butanoylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 82164610 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[(4-butanoylphenyl)sulfonylamino]acetic acid |
| SMILES | CCCC(=O)c1ccc(S(=O)(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO5S/c1-2-3-11(14)9-4-6-10(7-5-9)19(17,18)13-8-12(15)16/h4-7,13H,2-3,8H2,1H3,(H,15,16) |
| InChIKey | OWBDAQLNKZZRNN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |