C16H17BrClN3O4S — CID 3590285
N-[3-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]propoxy]phenyl]acetamide (PubChem CID 3590285) has the molecular formula C16H17BrClN3O4S and a molecular weight of 462.75 g/mol. Its IUPAC name is N-[3-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]propoxy]phenyl]acetamide.
| Compound Name | N-[3-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 3590285 |
| Molecular Formula | C16H17BrClN3O4S |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | N-[3-[3-[(5-bromo-6-chloro-3-pyridinyl)sulfonylamino]propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCCCNS(=O)(=O)c2cnc(Cl)c(Br)c2)c1 |
| InChI | InChI=1S/C16H17BrClN3O4S/c1-11(22)21-12-4-2-5-13(8-12)25-7-3-6-20-26(23,24)14-9-15(17)16(18)19-10-14/h2,4-5,8-10,20H,3,6-7H2,1H3,(H,21,22) |
| InChIKey | RUZKRZVZPHDSOZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|