C16H22N4O4S — CID 2810841
N-[3-[3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]propoxy]phenyl]acetamide (PubChem CID 2810841) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[3-[3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]propoxy]phenyl]acetamide.
| Compound Name | N-[3-[3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 2810841 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[3-[3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCCCNS(=O)(=O)c2cn(C)c(C)n2)c1 |
| InChI | InChI=1S/C16H22N4O4S/c1-12-18-16(11-20(12)3)25(22,23)17-8-5-9-24-15-7-4-6-14(10-15)19-13(2)21/h4,6-7,10-11,17H,5,8-9H2,1-3H3,(H,19,21) |
| InChIKey | CAXOXJOMNDVKNU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|