C11H8BrCl2NO2S2 — CID 3714744
5-bromo-N-[(2,5-dichlorophenyl)methyl]thiophene-2-sulfonamide (PubChem CID 3714744) has the molecular formula C11H8BrCl2NO2S2 and a molecular weight of 401.13 g/mol. Its IUPAC name is 5-bromo-N-[(2,5-dichlorophenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(2,5-dichlorophenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3714744 |
| Molecular Formula | C11H8BrCl2NO2S2 |
| Molecular Weight | 401.13 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | 5-bromo-N-[(2,5-dichlorophenyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cc(Cl)ccc1Cl)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H8BrCl2NO2S2/c12-10-3-4-11(18-10)19(16,17)15-6-7-5-8(13)1-2-9(7)14/h1-5,15H,6H2 |
| InChIKey | QTBQTMCPAOXTER-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.13 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |