C13H5F8NO2S — CID 3813246
2,3,4,5,6-pentafluoro-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide (PubChem CID 3813246) has the molecular formula C13H5F8NO2S and a molecular weight of 391.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3813246 |
| Molecular Formula | C13H5F8NO2S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H5F8NO2S/c14-5-2-1-4(6(15)7(5)16)3-22-25(23,24)13-11(20)9(18)8(17)10(19)12(13)21/h1-2,22H,3H2 |
| InChIKey | QSKDRCZJVUGISX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|