C15H12F3NO3S — CID 3783005
4-acetyl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide (PubChem CID 3783005) has the molecular formula C15H12F3NO3S and a molecular weight of 343.33 g/mol. Its IUPAC name is 4-acetyl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3783005 |
| Molecular Formula | C15H12F3NO3S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-acetyl-N-[(2,3,4-trifluorophenyl)methyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H12F3NO3S/c1-9(20)10-2-5-12(6-3-10)23(21,22)19-8-11-4-7-13(16)15(18)14(11)17/h2-7,19H,8H2,1H3 |
| InChIKey | IAFPOQYYPFFGJT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|