C14H9F6NO3 — CID 102337149
3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-4-methoxycyclobut-3-ene-1,2-dione (PubChem CID 102337149) has the molecular formula C14H9F6NO3 and a molecular weight of 353.22 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-4-methoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-4-methoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 102337149 |
| Molecular Formula | C14H9F6NO3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-4-methoxycyclobut-3-ene-1,2-dione |
| SMILES | COc1c(NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(=O)c1=O |
| InChI | InChI=1S/C14H9F6NO3/c1-24-12-9(10(22)11(12)23)21-5-6-2-7(13(15,16)17)4-8(3-6)14(18,19)20/h2-4,21H,5H2,1H3 |
| InChIKey | ITTNZBZSAKTCSH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|