C24H12F18N3OP — CID 102421192
N-bis[3,5-bis(trifluoromethyl)anilino]phosphoryl-3,5-bis(trifluoromethyl)aniline (PubChem CID 102421192) has the molecular formula C24H12F18N3OP and a molecular weight of 731.32 g/mol. Its IUPAC name is N-bis[3,5-bis(trifluoromethyl)anilino]phosphoryl-3,5-bis(trifluoromethyl)aniline.
| Compound Name | N-bis[3,5-bis(trifluoromethyl)anilino]phosphoryl-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 102421192 |
| Molecular Formula | C24H12F18N3OP |
| Molecular Weight | 731.32 g/mol |
| Exact Mass | 731.04 |
| IUPAC Name | N-bis[3,5-bis(trifluoromethyl)anilino]phosphoryl-3,5-bis(trifluoromethyl)aniline |
| SMILES | O=P(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H12F18N3OP/c25-19(26,27)10-1-11(20(28,29)30)5-16(4-10)43-47(46,44-17-6-12(21(31,32)33)2-13(7-17)22(34,35)36)45-18-8-14(23(37,38)39)3-15(9-18)24(40,41)42/h1-9H,(H3,43,44,45,46) |
| InChIKey | KZHGDSUSUQTJHA-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.32 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|