C38H24F24N2O2P2 — CID 101411688
trans-(1R,2R)-1-N,2-N-bis[bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl]cyclohexane-1,2-diamine (PubChem CID 101411688) has the molecular formula C38H24F24N2O2P2 and a molecular weight of 1058.52 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis[bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis[bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 101411688 |
| Molecular Formula | C38H24F24N2O2P2 |
| Molecular Weight | 1058.52 g/mol |
| Exact Mass | 1058.09 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis[bis[3,5-bis(trifluoromethyl)phenyl]phosphoryl]cyclohexane-1,2-diamine |
| SMILES | O=P(N[C@@H]1CCCC[C@H]1NP(=O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C38H24F24N2O2P2/c39-31(40,41)17-5-18(32(42,43)44)10-25(9-17)67(65,26-11-19(33(45,46)47)6-20(12-26)34(48,49)50)63-29-3-1-2-4-30(29)64-68(66,27-13-21(35(51,52)53)7-22(14-27)36(54,55)56)28-15-23(37(57,58)59)8-24(16-28)38(60,61)62/h5-16,29-30H,1-4H2,(H,63,65)(H,64,66)/t29-,30-/m1/s1 |
| InChIKey | UUPOBUDBQJAXSC-LOYHVIPDSA-N |
| XLogP | 13.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.52 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|