C20H20F6N2O2 — CID 132527776
3-[3,5-bis(trifluoromethyl)anilino]-4-[(1S,2R)-2-(dimethylamino)cyclohexyl]cyclobut-3-ene-1,2-dione (PubChem CID 132527776) has the molecular formula C20H20F6N2O2 and a molecular weight of 434.38 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-4-[(1S,2R)-2-(dimethylamino)cyclohexyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[(1S,2R)-2-(dimethylamino)cyclohexyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 132527776 |
| Molecular Formula | C20H20F6N2O2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[(1S,2R)-2-(dimethylamino)cyclohexyl]cyclobut-3-ene-1,2-dione |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1c1c(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(=O)c1=O |
| InChI | InChI=1S/C20H20F6N2O2/c1-28(2)14-6-4-3-5-13(14)15-16(18(30)17(15)29)27-12-8-10(19(21,22)23)7-11(9-12)20(24,25)26/h7-9,13-14,27H,3-6H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | IXRGZSBBUJUEKA-ZIAGYGMSSA-N |
| XLogP | 4.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|