C37H30F12N4O6 — CID 91936814
ethyl (2S,7R)-2,7-bis[[2-[3,5-bis(trifluoromethyl)anilino]-3,4-dioxocyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate (PubChem CID 91936814) has the molecular formula C37H30F12N4O6 and a molecular weight of 854.64 g/mol. Its IUPAC name is ethyl (2S,7R)-2,7-bis[[2-[3,5-bis(trifluoromethyl)anilino]-3,4-dioxocyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | ethyl (2S,7R)-2,7-bis[[2-[3,5-bis(trifluoromethyl)anilino]-3,4-dioxocyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 91936814 |
| Molecular Formula | C37H30F12N4O6 |
| Molecular Weight | 854.64 g/mol |
| Exact Mass | 854.20 |
| IUPAC Name | ethyl (2S,7R)-2,7-bis[[2-[3,5-bis(trifluoromethyl)anilino]-3,4-dioxocyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
| SMILES | CCOC(=O)C12CC[C@@H](Nc3c(Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)c(=O)c3=O)CC1C[C@@H](Nc1c(Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(=O)c1=O)CC2 |
| InChI | InChI=1S/C37H30F12N4O6/c1-2-59-32(58)33-5-3-20(50-24-26(30(56)28(24)54)52-22-11-16(34(38,39)40)7-17(12-22)35(41,42)43)9-15(33)10-21(4-6-33)51-25-27(31(57)29(25)55)53-23-13-18(36(44,45)46)8-19(14-23)37(47,48)49/h7-8,11-15,20-21,50-53H,2-6,9-10H2,1H3/t15?,20-,21+,33? |
| InChIKey | RCDDYFBBYQQEFH-OHZDXCFESA-N |
| XLogP | 8.24 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.64 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|