C35H32F6N4O6 — CID 91936811
ethyl (2S,7R)-2,7-bis[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate (PubChem CID 91936811) has the molecular formula C35H32F6N4O6 and a molecular weight of 718.65 g/mol. Its IUPAC name is ethyl (2S,7R)-2,7-bis[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | ethyl (2S,7R)-2,7-bis[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 91936811 |
| Molecular Formula | C35H32F6N4O6 |
| Molecular Weight | 718.65 g/mol |
| Exact Mass | 718.22 |
| IUPAC Name | ethyl (2S,7R)-2,7-bis[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
| SMILES | CCOC(=O)C12CC[C@@H](Nc3c(Nc4ccc(C(F)(F)F)cc4)c(=O)c3=O)CC1C[C@@H](Nc1c(Nc3ccc(C(F)(F)F)cc3)c(=O)c1=O)CC2 |
| InChI | InChI=1S/C35H32F6N4O6/c1-2-51-32(50)33-13-11-22(44-26-24(28(46)30(26)48)42-20-7-3-17(4-8-20)34(36,37)38)15-19(33)16-23(12-14-33)45-27-25(29(47)31(27)49)43-21-9-5-18(6-10-21)35(39,40)41/h3-10,19,22-23,42-45H,2,11-16H2,1H3/t19?,22-,23+,33? |
| InChIKey | STRQRHAWLTWLCG-BPWFXGJPSA-N |
| XLogP | 6.20 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|