C22H20F3NO3 — CID 1267087
ethyl (1R,6S)-2-oxo-6-phenyl-4-[4-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate (PubChem CID 1267087) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is ethyl (1R,6S)-2-oxo-6-phenyl-4-[4-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,6S)-2-oxo-6-phenyl-4-[4-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 1267087 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | ethyl (1R,6S)-2-oxo-6-phenyl-4-[4-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=C(Nc2ccc(C(F)(F)F)cc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H20F3NO3/c1-2-29-21(28)20-18(14-6-4-3-5-7-14)12-17(13-19(20)27)26-16-10-8-15(9-11-16)22(23,24)25/h3-11,13,18,20,26H,2,12H2,1H3/t18-,20-/m1/s1 |
| InChIKey | NXJYWPJCNNHJSB-UYAOXDASSA-N |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|