C17H18F3NO4 — CID 15186895
ethyl 6-methyl-2-oxo-4-[4-(trifluoromethoxy)anilino]cyclohex-3-ene-1-carboxylate (PubChem CID 15186895) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is ethyl 6-methyl-2-oxo-4-[4-(trifluoromethoxy)anilino]cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 6-methyl-2-oxo-4-[4-(trifluoromethoxy)anilino]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 15186895 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | ethyl 6-methyl-2-oxo-4-[4-(trifluoromethoxy)anilino]cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(Nc2ccc(OC(F)(F)F)cc2)CC1C |
| InChI | InChI=1S/C17H18F3NO4/c1-3-24-16(23)15-10(2)8-12(9-14(15)22)21-11-4-6-13(7-5-11)25-17(18,19)20/h4-7,9-10,15,21H,3,8H2,1-2H3 |
| InChIKey | VSXVOOVIITXPMG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|