C18H23NO3 — CID 10040534
ethyl (1S,6R)-4-(3-ethylanilino)-6-methyl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 10040534) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is ethyl (1S,6R)-4-(3-ethylanilino)-6-methyl-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6R)-4-(3-ethylanilino)-6-methyl-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10040534 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | ethyl (1S,6R)-4-(3-ethylanilino)-6-methyl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C=C(Nc2cccc(CC)c2)C[C@H]1C |
| InChI | InChI=1S/C18H23NO3/c1-4-13-7-6-8-14(10-13)19-15-9-12(3)17(16(20)11-15)18(21)22-5-2/h6-8,10-12,17,19H,4-5,9H2,1-3H3/t12-,17+/m1/s1 |
| InChIKey | ORFXLKOFQIFSJA-PXAZEXFGSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|