C22H20F3NO4 — CID 1267085
methyl (1R,6R)-6-(4-methoxyphenyl)-2-oxo-4-[3-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate (PubChem CID 1267085) has the molecular formula C22H20F3NO4 and a molecular weight of 419.40 g/mol. Its IUPAC name is methyl (1R,6R)-6-(4-methoxyphenyl)-2-oxo-4-[3-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,6R)-6-(4-methoxyphenyl)-2-oxo-4-[3-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 1267085 |
| Molecular Formula | C22H20F3NO4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl (1R,6R)-6-(4-methoxyphenyl)-2-oxo-4-[3-(trifluoromethyl)anilino]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C=C(Nc2cccc(C(F)(F)F)c2)C[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H20F3NO4/c1-29-17-8-6-13(7-9-17)18-11-16(12-19(27)20(18)21(28)30-2)26-15-5-3-4-14(10-15)22(23,24)25/h3-10,12,18,20,26H,11H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | HWJJOBKUNHIIFR-AZUAARDMSA-N |
| XLogP | 4.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|