C19H23F3N2O3 — CID 166462730
ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate (PubChem CID 166462730) has the molecular formula C19H23F3N2O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate.
| Compound Name | ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate |
|---|---|
| PubChem CID | 166462730 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=C1/C=C(Nc2ccc(OC(F)(F)F)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H23F3N2O3/c1-4-26-17(25)12-23-14-9-15(11-18(2,3)10-14)24-13-5-7-16(8-6-13)27-19(20,21)22/h5-9,24H,4,10-12H2,1-3H3/b23-14- |
| InChIKey | CTDJAHKRJSTGPC-UCQKPKSFSA-N |
| XLogP | 4.71 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|