About ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate
ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate (PubChem CID 166462730) has the molecular formula C19H23F3N2O3
and a molecular weight of 384.40 g/mol. Its IUPAC name is ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate |
| PubChem CID | 166462730 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=C1/C=C(Nc2ccc(OC(F)(F)F)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H23F3N2O3/c1-4-26-17(25)12-23-14-9-15(11-18(2,3)10-14)24-13-5-7-16(8-6-13)27-19(20,21)22/h5-9,24H,4,10-12H2,1-3H3/b23-14- |
| InChIKey | CTDJAHKRJSTGPC-UCQKPKSFSA-N |
| XLogP | 4.71 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate?
The IUPAC name of ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate (CID 166462730) is ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate.
What is the SMILES notation for ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate?
The canonical SMILES for ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate is CCOC(=O)C/N=C1/C=C(Nc2ccc(OC(F)(F)F)cc2)CC(C)(C)C1.
What is the InChIKey of ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate?
The InChIKey is CTDJAHKRJSTGPC-UCQKPKSFSA-N. The full InChI is InChI=1S/C19H23F3N2O3/c1-4-26-17(25)12-23-14-9-15(11-18(2,3)10-14)24-13-5-7-16(8-6-13)27-19(20,21)22/h5-9,24H,4,10-12H2,1-3H3/b23-14-.
What are the key properties of ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate?
ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate has a molecular weight of 384.40 g/mol, XLogP of 4.71, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-ylidene]amino]acetate is sourced from PubChem (CID 166462730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).