C17H13ClF4N2O4 — CID 176913566
ethyl 3-[6-chloro-5-fluoro-2-[4-(trifluoromethoxy)anilino]-3-pyridinyl]-3-oxopropanoate (PubChem CID 176913566) has the molecular formula C17H13ClF4N2O4 and a molecular weight of 420.75 g/mol. Its IUPAC name is ethyl 3-[6-chloro-5-fluoro-2-[4-(trifluoromethoxy)anilino]-3-pyridinyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[6-chloro-5-fluoro-2-[4-(trifluoromethoxy)anilino]-3-pyridinyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 176913566 |
| Molecular Formula | C17H13ClF4N2O4 |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | ethyl 3-[6-chloro-5-fluoro-2-[4-(trifluoromethoxy)anilino]-3-pyridinyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(Cl)nc1Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13ClF4N2O4/c1-2-27-14(26)8-13(25)11-7-12(19)15(18)24-16(11)23-9-3-5-10(6-4-9)28-17(20,21)22/h3-7H,2,8H2,1H3,(H,23,24) |
| InChIKey | AUVBGCDWKMMHNQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|