C30H36F3N3O4 — CID 130363888
ethyl 3-[6-methyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]-3-oxopropanoate (PubChem CID 130363888) has the molecular formula C30H36F3N3O4 and a molecular weight of 559.63 g/mol. Its IUPAC name is ethyl 3-[6-methyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[6-methyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 130363888 |
| Molecular Formula | C30H36F3N3O4 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | ethyl 3-[6-methyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazol-5-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc2nc(Nc3ccc(OC(F)(F)F)cc3)n(C3CC(C)(C)CC(C)(C)C3)c2cc1C |
| InChI | InChI=1S/C30H36F3N3O4/c1-7-39-26(38)14-25(37)22-13-23-24(12-18(22)2)36(20-15-28(3,4)17-29(5,6)16-20)27(35-23)34-19-8-10-21(11-9-19)40-30(31,32)33/h8-13,20H,7,14-17H2,1-6H3,(H,34,35) |
| InChIKey | LVPORYVQYQJMBY-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|