C27H33F3N4O2S — CID 144901579
6-methyl-N-methylsulfanyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxamide (PubChem CID 144901579) has the molecular formula C27H33F3N4O2S and a molecular weight of 534.65 g/mol. Its IUPAC name is 6-methyl-N-methylsulfanyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxamide.
| Compound Name | 6-methyl-N-methylsulfanyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 144901579 |
| Molecular Formula | C27H33F3N4O2S |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 6-methyl-N-methylsulfanyl-1-(3,3,5,5-tetramethylcyclohexyl)-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxamide |
| SMILES | CSNC(=O)c1cc2nc(Nc3ccc(OC(F)(F)F)cc3)n(C3CC(C)(C)CC(C)(C)C3)c2cc1C |
| InChI | InChI=1S/C27H33F3N4O2S/c1-16-11-22-21(12-20(16)23(35)33-37-6)32-24(31-17-7-9-19(10-8-17)36-27(28,29)30)34(22)18-13-25(2,3)15-26(4,5)14-18/h7-12,18H,13-15H2,1-6H3,(H,31,32)(H,33,35) |
| InChIKey | SVNDROKTCPIIAM-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|