C27H28F3NO5 — CID 58007883
ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)anilino]phenoxy]acetate (PubChem CID 58007883) has the molecular formula C27H28F3NO5 and a molecular weight of 503.52 g/mol. Its IUPAC name is ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)anilino]phenoxy]acetate.
| Compound Name | ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)anilino]phenoxy]acetate |
|---|---|
| PubChem CID | 58007883 |
| Molecular Formula | C27H28F3NO5 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)anilino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Nc2ccc(OC(F)(F)F)cc2)cc1Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H28F3NO5/c1-5-33-25(32)17-34-23-15-10-20(31-19-8-13-22(14-9-19)36-27(28,29)30)16-24(23)35-21-11-6-18(7-12-21)26(2,3)4/h6-16,31H,5,17H2,1-4H3 |
| InChIKey | CTPHJCJQBVCDJA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |