C31H35F3O5 — CID 58008125
ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenoxy]hexanoate (PubChem CID 58008125) has the molecular formula C31H35F3O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenoxy]hexanoate.
| Compound Name | ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 58008125 |
| Molecular Formula | C31H35F3O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | ethyl 2-[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenoxy]hexanoate |
| SMILES | CCCCC(Oc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1Oc1ccc(C(C)(C)C)cc1)C(=O)OCC |
| InChI | InChI=1S/C31H35F3O5/c1-6-8-9-27(29(35)36-7-2)38-26-19-12-22(21-10-15-25(16-11-21)39-31(32,33)34)20-28(26)37-24-17-13-23(14-18-24)30(3,4)5/h10-20,27H,6-9H2,1-5H3 |
| InChIKey | IJOQEWJZNZSPLA-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |