C26H25F3O3 — CID 90919320
2-(4-tert-butylphenoxy)-1-(2-methoxyethenyl)-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 90919320) has the molecular formula C26H25F3O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-1-(2-methoxyethenyl)-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 2-(4-tert-butylphenoxy)-1-(2-methoxyethenyl)-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 90919320 |
| Molecular Formula | C26H25F3O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-1-(2-methoxyethenyl)-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | COC=Cc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H25F3O3/c1-25(2,3)21-9-13-22(14-10-21)31-24-17-20(6-5-19(24)15-16-30-4)18-7-11-23(12-8-18)32-26(27,28)29/h5-17H,1-4H3 |
| InChIKey | MCYPFNZVSOYTJW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|