C27H25F3O4 — CID 89139577
(3E)-4-[2-(4-butoxyphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]buta-1,3-dien-2-ol (PubChem CID 89139577) has the molecular formula C27H25F3O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is (3E)-4-[2-(4-butoxyphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]buta-1,3-dien-2-ol.
| Compound Name | (3E)-4-[2-(4-butoxyphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]buta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 89139577 |
| Molecular Formula | C27H25F3O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (3E)-4-[2-(4-butoxyphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]buta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C/c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1Oc1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C27H25F3O4/c1-3-4-17-32-23-13-15-24(16-14-23)33-26-18-22(8-7-21(26)6-5-19(2)31)20-9-11-25(12-10-20)34-27(28,29)30/h5-16,18,31H,2-4,17H2,1H3/b6-5+ |
| InChIKey | KIBDRCUQYKSBQL-AATRIKPKSA-N |
| XLogP | 8.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|