C24H27F3O5 — CID 142370018
ethyl (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethoxy)phenyl]prop-2-enoate (PubChem CID 142370018) has the molecular formula C24H27F3O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142370018 |
| Molecular Formula | C24H27F3O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | ethyl (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethoxy)phenyl]prop-2-enoate |
| SMILES | CCCCOCCOc1ccc(-c2ccc(OC(F)(F)F)c(/C=C/C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C24H27F3O5/c1-3-5-14-29-15-16-31-21-10-6-18(7-11-21)19-8-12-22(32-24(25,26)27)20(17-19)9-13-23(28)30-4-2/h6-13,17H,3-5,14-16H2,1-2H3/b13-9+ |
| InChIKey | LIVMUWFXDUTATF-UKTHLTGXSA-N |
| XLogP | 6.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|