C30H41NO4 — CID 86606626
ethyl (E)-3-[2-(azocan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]prop-2-enoate (PubChem CID 86606626) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is ethyl (E)-3-[2-(azocan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(azocan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86606626 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | ethyl (E)-3-[2-(azocan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]prop-2-enoate |
| SMILES | CCCCOCCOc1ccc(-c2ccc(N3CCCCCCC3)c(/C=C/C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C30H41NO4/c1-3-5-21-33-22-23-35-28-15-11-25(12-16-28)26-13-17-29(31-19-9-7-6-8-10-20-31)27(24-26)14-18-30(32)34-4-2/h11-18,24H,3-10,19-23H2,1-2H3/b18-14+ |
| InChIKey | CNJSXLVJRYIWFJ-NBVRZTHBSA-N |
| XLogP | 6.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|