C28H35NO5 — CID 91387000
ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3-oxopyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate (PubChem CID 91387000) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3-oxopyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3-oxopyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91387000 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3-oxopyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate |
| SMILES | CCCCOCCOc1ccc(-c2ccc(N3CCC(=O)C3)c(C=C(C)C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C28H35NO5/c1-4-6-15-32-16-17-34-26-10-7-22(8-11-26)23-9-12-27(29-14-13-25(30)20-29)24(19-23)18-21(3)28(31)33-5-2/h7-12,18-19H,4-6,13-17,20H2,1-3H3 |
| InChIKey | CEZGHFFTKPLWNJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|