C29H40N2O4 — CID 91323486
ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3,4-dimethylpyrrolidin-1-yl)-3-pyridinyl]-2-methylprop-2-enoate (PubChem CID 91323486) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3,4-dimethylpyrrolidin-1-yl)-3-pyridinyl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3,4-dimethylpyrrolidin-1-yl)-3-pyridinyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91323486 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-(3,4-dimethylpyrrolidin-1-yl)-3-pyridinyl]-2-methylprop-2-enoate |
| SMILES | CCCCOCCOc1ccc(-c2cnc(N3CC(C)C(C)C3)c(C=C(C)C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C29H40N2O4/c1-6-8-13-33-14-15-35-27-11-9-24(10-12-27)26-17-25(16-21(3)29(32)34-7-2)28(30-18-26)31-19-22(4)23(5)20-31/h9-12,16-18,22-23H,6-8,13-15,19-20H2,1-5H3 |
| InChIKey | KOUDYMFWYVPJFT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|