C25H28N2O4 — CID 23091014
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-pyrazol-1-ylphenyl]-2-methylprop-2-enoic acid (PubChem CID 23091014) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-pyrazol-1-ylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-pyrazol-1-ylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 23091014 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-pyrazol-1-ylphenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCOCCOc1ccc(-c2ccc(-n3cccn3)c(/C=C(\C)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-3-4-14-30-15-16-31-23-9-6-20(7-10-23)21-8-11-24(27-13-5-12-26-27)22(18-21)17-19(2)25(28)29/h5-13,17-18H,3-4,14-16H2,1-2H3,(H,28,29)/b19-17+ |
| InChIKey | WYEHXXNRFRRXME-HTXNQAPBSA-N |
| XLogP | 5.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|