C31H43NO4 — CID 91166231
ethyl 2-[[2-(azepan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]methylidene]butanoate (PubChem CID 91166231) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is ethyl 2-[[2-(azepan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]methylidene]butanoate.
| Compound Name | ethyl 2-[[2-(azepan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 91166231 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | ethyl 2-[[2-(azepan-1-yl)-5-[4-(2-butoxyethoxy)phenyl]phenyl]methylidene]butanoate |
| SMILES | CCCCOCCOc1ccc(-c2ccc(N3CCCCCC3)c(C=C(CC)C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C31H43NO4/c1-4-7-20-34-21-22-36-29-15-12-26(13-16-29)27-14-17-30(32-18-10-8-9-11-19-32)28(24-27)23-25(5-2)31(33)35-6-3/h12-17,23-24H,4-11,18-22H2,1-3H3 |
| InChIKey | DKBUZGDRQLSOPM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|