C22H30N4O2 — CID 3224267
N-(4-butoxyphenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 3224267) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(4-butoxyphenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3224267 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-(4-butoxyphenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)C2CCCN(c3nc(C)cc(C)n3)C2)cc1 |
| InChI | InChI=1S/C22H30N4O2/c1-4-5-13-28-20-10-8-19(9-11-20)25-21(27)18-7-6-12-26(15-18)22-23-16(2)14-17(3)24-22/h8-11,14,18H,4-7,12-13,15H2,1-3H3,(H,25,27) |
| InChIKey | AZFKDXGSEDDKRB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|