C26H34N2O4 — CID 87830754
(5E)-3-[4-(2-butoxyethoxy)phenyl]-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylic acid (PubChem CID 87830754) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is (5E)-3-[4-(2-butoxyethoxy)phenyl]-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylic acid.
| Compound Name | (5E)-3-[4-(2-butoxyethoxy)phenyl]-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylic acid |
|---|---|
| PubChem CID | 87830754 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (5E)-3-[4-(2-butoxyethoxy)phenyl]-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylic acid |
| SMILES | CCCCOCCOc1ccc(-c2cnc3c(c2)/C=C(/C(=O)O)CCCN3CCC)cc1 |
| InChI | InChI=1S/C26H34N2O4/c1-3-5-14-31-15-16-32-24-10-8-20(9-11-24)23-18-22-17-21(26(29)30)7-6-13-28(12-4-2)25(22)27-19-23/h8-11,17-19H,3-7,12-16H2,1-2H3,(H,29,30)/b21-17+ |
| InChIKey | VEDVPTVJBLBVLN-HEHNFIMWSA-N |
| XLogP | 5.42 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|