C29H41NO4 — CID 90999154
ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-[ethyl(2-methylpropyl)amino]phenyl]prop-2-enoate (PubChem CID 90999154) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-[ethyl(2-methylpropyl)amino]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-[ethyl(2-methylpropyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90999154 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | ethyl 3-[5-[4-(2-butoxyethoxy)phenyl]-2-[ethyl(2-methylpropyl)amino]phenyl]prop-2-enoate |
| SMILES | CCCCOCCOc1ccc(-c2ccc(N(CC)CC(C)C)c(C=CC(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C29H41NO4/c1-6-9-18-32-19-20-34-27-14-10-24(11-15-27)25-12-16-28(30(7-2)22-23(4)5)26(21-25)13-17-29(31)33-8-3/h10-17,21,23H,6-9,18-20,22H2,1-5H3 |
| InChIKey | XRRYCYBMWKCLIS-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|