C24H30O4 — CID 146247260
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-yloxyphenyl]prop-2-enal (PubChem CID 146247260) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-yloxyphenyl]prop-2-enal.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-yloxyphenyl]prop-2-enal |
|---|---|
| PubChem CID | 146247260 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-yloxyphenyl]prop-2-enal |
| SMILES | CCCCOCCOc1ccc(-c2ccc(OC(C)C)c(/C=C/C=O)c2)cc1 |
| InChI | InChI=1S/C24H30O4/c1-4-5-15-26-16-17-27-23-11-8-20(9-12-23)21-10-13-24(28-19(2)3)22(18-21)7-6-14-25/h6-14,18-19H,4-5,15-17H2,1-3H3/b7-6+ |
| InChIKey | BKJQHPWTAIDRFF-VOTSOKGWSA-N |
| XLogP | 5.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|