C22H24F2O4 — CID 146247056
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(difluoromethoxy)phenyl]prop-2-enal (PubChem CID 146247056) has the molecular formula C22H24F2O4 and a molecular weight of 390.43 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(difluoromethoxy)phenyl]prop-2-enal.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(difluoromethoxy)phenyl]prop-2-enal |
|---|---|
| PubChem CID | 146247056 |
| Molecular Formula | C22H24F2O4 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(difluoromethoxy)phenyl]prop-2-enal |
| SMILES | CCCCOCCOc1ccc(-c2ccc(OC(F)F)c(/C=C/C=O)c2)cc1 |
| InChI | InChI=1S/C22H24F2O4/c1-2-3-13-26-14-15-27-20-9-6-17(7-10-20)18-8-11-21(28-22(23)24)19(16-18)5-4-12-25/h4-12,16,22H,2-3,13-15H2,1H3/b5-4+ |
| InChIKey | OKJULMXITIATOR-SNAWJCMRSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|