C22H28O3 — CID 146247123
1-ethoxy-2-[(E)-prop-1-enyl]-4-[4-(2-propoxyethoxy)phenyl]benzene (PubChem CID 146247123) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-ethoxy-2-[(E)-prop-1-enyl]-4-[4-(2-propoxyethoxy)phenyl]benzene.
| Compound Name | 1-ethoxy-2-[(E)-prop-1-enyl]-4-[4-(2-propoxyethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 146247123 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-ethoxy-2-[(E)-prop-1-enyl]-4-[4-(2-propoxyethoxy)phenyl]benzene |
| SMILES | C/C=C/c1cc(-c2ccc(OCCOCCC)cc2)ccc1OCC |
| InChI | InChI=1S/C22H28O3/c1-4-7-20-17-19(10-13-22(20)24-6-3)18-8-11-21(12-9-18)25-16-15-23-14-5-2/h4,7-13,17H,5-6,14-16H2,1-3H3/b7-4+ |
| InChIKey | KUPJTDDMXIOOAO-QPJJXVBHSA-N |
| XLogP | 5.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|