C27H29NO5 — CID 145109612
[2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-[2-(2-hydroxyethoxy)ethoxy]benzoate (PubChem CID 145109612) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is [2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-[2-(2-hydroxyethoxy)ethoxy]benzoate.
| Compound Name | [2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-[2-(2-hydroxyethoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 145109612 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-[2-(2-hydroxyethoxy)ethoxy]benzoate |
| SMILES | [H]/N=C/c1cc(-c2ccc(CCC)cc2)ccc1OC(=O)c1ccc(OCCOCCO)cc1 |
| InChI | InChI=1S/C27H29NO5/c1-2-3-20-4-6-21(7-5-20)23-10-13-26(24(18-23)19-28)33-27(30)22-8-11-25(12-9-22)32-17-16-31-15-14-29/h4-13,18-19,28-29H,2-3,14-17H2,1H3/b28-19+ |
| InChIKey | PJGBZIIUJCVGRR-TURZUDJPSA-N |
| XLogP | 4.91 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|