C34H41N3O4 — CID 166924619
(E)-3-[2-ethoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(E)-2-(propyliminomethylamino)ethenyl]phenyl]prop-2-enamide (PubChem CID 166924619) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is (E)-3-[2-ethoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(E)-2-(propyliminomethylamino)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-ethoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(E)-2-(propyliminomethylamino)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166924619 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | (E)-3-[2-ethoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(E)-2-(propyliminomethylamino)ethenyl]phenyl]prop-2-enamide |
| SMILES | CCC/N=C/N/C=C/c1ccc(NC(=O)/C=C/c2cc(-c3ccc(OCCOCCC)cc3)ccc2OCC)cc1 |
| InChI | InChI=1S/C34H41N3O4/c1-4-20-35-26-36-21-19-27-7-13-31(14-8-27)37-34(38)18-12-30-25-29(11-17-33(30)40-6-3)28-9-15-32(16-10-28)41-24-23-39-22-5-2/h7-19,21,25-26H,4-6,20,22-24H2,1-3H3,(H,35,36)(H,37,38)/b18-12+,21-19+ |
| InChIKey | GRDLRWAGWZURFS-ZPGLHWHJSA-N |
| XLogP | 7.21 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|