C26H26F4O2 — CID 67799885
1-(difluoromethoxy)-2-fluoro-4-[3-fluoro-4-(4-heptoxyphenyl)phenyl]benzene (PubChem CID 67799885) has the molecular formula C26H26F4O2 and a molecular weight of 446.48 g/mol. Its IUPAC name is 1-(difluoromethoxy)-2-fluoro-4-[3-fluoro-4-(4-heptoxyphenyl)phenyl]benzene.
| Compound Name | 1-(difluoromethoxy)-2-fluoro-4-[3-fluoro-4-(4-heptoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 67799885 |
| Molecular Formula | C26H26F4O2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-(difluoromethoxy)-2-fluoro-4-[3-fluoro-4-(4-heptoxyphenyl)phenyl]benzene |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(OC(F)F)c(F)c3)cc2F)cc1 |
| InChI | InChI=1S/C26H26F4O2/c1-2-3-4-5-6-15-31-21-11-7-18(8-12-21)22-13-9-19(16-23(22)27)20-10-14-25(24(28)17-20)32-26(29)30/h7-14,16-17,26H,2-6,15H2,1H3 |
| InChIKey | GZEQZVHVMIGSIJ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|