C33H42F2O2 — CID 14766271
2-fluoro-4-[3-fluoro-4-[(2R)-heptan-2-yl]oxyphenyl]-1-(4-octoxyphenyl)benzene (PubChem CID 14766271) has the molecular formula C33H42F2O2 and a molecular weight of 508.69 g/mol. Its IUPAC name is 2-fluoro-4-[3-fluoro-4-[(2R)-heptan-2-yl]oxyphenyl]-1-(4-octoxyphenyl)benzene.
| Compound Name | 2-fluoro-4-[3-fluoro-4-[(2R)-heptan-2-yl]oxyphenyl]-1-(4-octoxyphenyl)benzene |
|---|---|
| PubChem CID | 14766271 |
| Molecular Formula | C33H42F2O2 |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 2-fluoro-4-[3-fluoro-4-[(2R)-heptan-2-yl]oxyphenyl]-1-(4-octoxyphenyl)benzene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(O[C@H](C)CCCCC)c(F)c3)cc2F)cc1 |
| InChI | InChI=1S/C33H42F2O2/c1-4-6-8-9-10-12-22-36-29-18-14-26(15-19-29)30-20-16-27(23-31(30)34)28-17-21-33(32(35)24-28)37-25(3)13-11-7-5-2/h14-21,23-25H,4-13,22H2,1-3H3/t25-/m1/s1 |
| InChIKey | WZBYRBVXXBCWGK-RUZDIDTESA-N |
| XLogP | 10.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|