C17H22BrNO2 — CID 86606664
ethyl (E)-3-[5-bromo-2-(3-methylpyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate (PubChem CID 86606664) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is ethyl (E)-3-[5-bromo-2-(3-methylpyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[5-bromo-2-(3-methylpyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86606664 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | ethyl (E)-3-[5-bromo-2-(3-methylpyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc(Br)ccc1N1CCC(C)C1 |
| InChI | InChI=1S/C17H22BrNO2/c1-4-21-17(20)13(3)9-14-10-15(18)5-6-16(14)19-8-7-12(2)11-19/h5-6,9-10,12H,4,7-8,11H2,1-3H3/b13-9+ |
| InChIKey | JTWJQHWBCPWRJB-UKTHLTGXSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|